C19H23N3O6S2 — CID 30872740
phenyl 2-[6-(dimethylsulfamoyl)-3-ethyl-2-oxobenzimidazol-1-yl]ethanesulfonate (PubChem CID 30872740) has the molecular formula C19H23N3O6S2 and a molecular weight of 453.54 g/mol. Its IUPAC name is phenyl 2-[6-(dimethylsulfamoyl)-3-ethyl-2-oxobenzimidazol-1-yl]ethanesulfonate.
| Compound Name | phenyl 2-[6-(dimethylsulfamoyl)-3-ethyl-2-oxobenzimidazol-1-yl]ethanesulfonate |
|---|---|
| PubChem CID | 30872740 |
| Molecular Formula | C19H23N3O6S2 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | phenyl 2-[6-(dimethylsulfamoyl)-3-ethyl-2-oxobenzimidazol-1-yl]ethanesulfonate |
| SMILES | CCn1c(=O)n(CCS(=O)(=O)Oc2ccccc2)c2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C19H23N3O6S2/c1-4-21-17-11-10-16(30(26,27)20(2)3)14-18(17)22(19(21)23)12-13-29(24,25)28-15-8-6-5-7-9-15/h5-11,14H,4,12-13H2,1-3H3 |
| InChIKey | ACVGDGVMKHFPFX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 107.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|