C21H20ClN5O5S — CID 55554248
4-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-1-ethyl-N,N-dimethyl-2,3-dioxoquinoxaline-6-sulfonamide (PubChem CID 55554248) has the molecular formula C21H20ClN5O5S and a molecular weight of 489.94 g/mol. Its IUPAC name is 4-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-1-ethyl-N,N-dimethyl-2,3-dioxoquinoxaline-6-sulfonamide.
| Compound Name | 4-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-1-ethyl-N,N-dimethyl-2,3-dioxoquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 55554248 |
| Molecular Formula | C21H20ClN5O5S |
| Molecular Weight | 489.94 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | 4-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-1-ethyl-N,N-dimethyl-2,3-dioxoquinoxaline-6-sulfonamide |
| SMILES | CCn1c(=O)c(=O)n(Cc2nnc(-c3ccccc3Cl)o2)c2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C21H20ClN5O5S/c1-4-26-16-10-9-13(33(30,31)25(2)3)11-17(16)27(21(29)20(26)28)12-18-23-24-19(32-18)14-7-5-6-8-15(14)22/h5-11H,4,12H2,1-3H3 |
| InChIKey | PCGSWCNDNCPGNZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 120.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.94 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|