C20H27N3O4S — CID 124721436
4-[[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]methyl]-1-ethyl-N,N-dimethyl-2,3-dioxoquinoxaline-6-sulfonamide (PubChem CID 124721436) has the molecular formula C20H27N3O4S and a molecular weight of 405.52 g/mol. Its IUPAC name is 4-[[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]methyl]-1-ethyl-N,N-dimethyl-2,3-dioxoquinoxaline-6-sulfonamide.
| Compound Name | 4-[[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]methyl]-1-ethyl-N,N-dimethyl-2,3-dioxoquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 124721436 |
| Molecular Formula | C20H27N3O4S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 4-[[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]methyl]-1-ethyl-N,N-dimethyl-2,3-dioxoquinoxaline-6-sulfonamide |
| SMILES | CCn1c(=O)c(=O)n(C[C@@H]2C[C@H]3CC[C@H]2C3)c2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C20H27N3O4S/c1-4-22-17-8-7-16(28(26,27)21(2)3)11-18(17)23(20(25)19(22)24)12-15-10-13-5-6-14(15)9-13/h7-8,11,13-15H,4-6,9-10,12H2,1-3H3/t13-,14-,15-/m0/s1 |
| InChIKey | ACWBKXUMLGBPAM-KKUMJFAQSA-N |
| XLogP | 1.87 |
| TPSA | 81.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|