C20H22FN3O5S — CID 55359265
1-ethyl-4-[(5-fluoro-2-methoxyphenyl)methyl]-N,N-dimethyl-2,3-dioxoquinoxaline-6-sulfonamide (PubChem CID 55359265) has the molecular formula C20H22FN3O5S and a molecular weight of 435.48 g/mol. Its IUPAC name is 1-ethyl-4-[(5-fluoro-2-methoxyphenyl)methyl]-N,N-dimethyl-2,3-dioxoquinoxaline-6-sulfonamide.
| Compound Name | 1-ethyl-4-[(5-fluoro-2-methoxyphenyl)methyl]-N,N-dimethyl-2,3-dioxoquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 55359265 |
| Molecular Formula | C20H22FN3O5S |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 1-ethyl-4-[(5-fluoro-2-methoxyphenyl)methyl]-N,N-dimethyl-2,3-dioxoquinoxaline-6-sulfonamide |
| SMILES | CCn1c(=O)c(=O)n(Cc2cc(F)ccc2OC)c2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C20H22FN3O5S/c1-5-23-16-8-7-15(30(27,28)22(2)3)11-17(16)24(20(26)19(23)25)12-13-10-14(21)6-9-18(13)29-4/h6-11H,5,12H2,1-4H3 |
| InChIKey | IPSVIHYLGRNVGQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 90.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|