C9H9FO6S — CID 82049845
2-(3-fluoro-4-methoxyphenyl)sulfonyloxyacetic acid (PubChem CID 82049845) has the molecular formula C9H9FO6S and a molecular weight of 264.23 g/mol. Its IUPAC name is 2-(3-fluoro-4-methoxyphenyl)sulfonyloxyacetic acid.
| Compound Name | 2-(3-fluoro-4-methoxyphenyl)sulfonyloxyacetic acid |
|---|---|
| PubChem CID | 82049845 |
| Molecular Formula | C9H9FO6S |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | 2-(3-fluoro-4-methoxyphenyl)sulfonyloxyacetic acid |
| SMILES | COc1ccc(S(=O)(=O)OCC(=O)O)cc1F |
| InChI | InChI=1S/C9H9FO6S/c1-15-8-3-2-6(4-7(8)10)17(13,14)16-5-9(11)12/h2-4H,5H2,1H3,(H,11,12) |
| InChIKey | GRSVKHFPPUNSOC-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|