C13H17NO2S — CID 82050777
1-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-2-propylsulfanylethanone (PubChem CID 82050777) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-2-propylsulfanylethanone.
| Compound Name | 1-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-2-propylsulfanylethanone |
|---|---|
| PubChem CID | 82050777 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-2-propylsulfanylethanone |
| SMILES | CCCSCC(=O)c1ccc2c(c1)NCCO2 |
| InChI | InChI=1S/C13H17NO2S/c1-2-7-17-9-12(15)10-3-4-13-11(8-10)14-5-6-16-13/h3-4,8,14H,2,5-7,9H2,1H3 |
| InChIKey | QFNGNAFMZUOODQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|