C18H20N2O3 — CID 95416716
1-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-2-[2-(4-hydroxyphenyl)ethylamino]ethanone (PubChem CID 95416716) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-2-[2-(4-hydroxyphenyl)ethylamino]ethanone.
| Compound Name | 1-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-2-[2-(4-hydroxyphenyl)ethylamino]ethanone |
|---|---|
| PubChem CID | 95416716 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-2-[2-(4-hydroxyphenyl)ethylamino]ethanone |
| SMILES | O=C(CNCCc1ccc(O)cc1)c1ccc2c(c1)NCCO2 |
| InChI | InChI=1S/C18H20N2O3/c21-15-4-1-13(2-5-15)7-8-19-12-17(22)14-3-6-18-16(11-14)20-9-10-23-18/h1-6,11,19-21H,7-10,12H2 |
| InChIKey | SLMXYLOYEUHKCD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|