C14H17BrO4 — CID 82051290
4-[5-bromo-2-(2-methylpropoxy)phenyl]-4-oxobutanoic acid (PubChem CID 82051290) has the molecular formula C14H17BrO4 and a molecular weight of 329.19 g/mol. Its IUPAC name is 4-[5-bromo-2-(2-methylpropoxy)phenyl]-4-oxobutanoic acid.
| Compound Name | 4-[5-bromo-2-(2-methylpropoxy)phenyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 82051290 |
| Molecular Formula | C14H17BrO4 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 4-[5-bromo-2-(2-methylpropoxy)phenyl]-4-oxobutanoic acid |
| SMILES | CC(C)COc1ccc(Br)cc1C(=O)CCC(=O)O |
| InChI | InChI=1S/C14H17BrO4/c1-9(2)8-19-13-5-3-10(15)7-11(13)12(16)4-6-14(17)18/h3,5,7,9H,4,6,8H2,1-2H3,(H,17,18) |
| InChIKey | BMLPEULNMGUNSC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |