C19H29NO2 — CID 82053134
3-(azepan-1-yl)-1-(4-ethoxy-2,6-dimethylphenyl)propan-1-one (PubChem CID 82053134) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 3-(azepan-1-yl)-1-(4-ethoxy-2,6-dimethylphenyl)propan-1-one.
| Compound Name | 3-(azepan-1-yl)-1-(4-ethoxy-2,6-dimethylphenyl)propan-1-one |
|---|---|
| PubChem CID | 82053134 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | 3-(azepan-1-yl)-1-(4-ethoxy-2,6-dimethylphenyl)propan-1-one |
| SMILES | CCOc1cc(C)c(C(=O)CCN2CCCCCC2)c(C)c1 |
| InChI | InChI=1S/C19H29NO2/c1-4-22-17-13-15(2)19(16(3)14-17)18(21)9-12-20-10-7-5-6-8-11-20/h13-14H,4-12H2,1-3H3 |
| InChIKey | ANKULISABRIDJQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |