C12H16O3 — CID 82053664
2-methoxy-1-(4-methoxy-2,3-dimethylphenyl)ethanone (PubChem CID 82053664) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-methoxy-1-(4-methoxy-2,3-dimethylphenyl)ethanone.
| Compound Name | 2-methoxy-1-(4-methoxy-2,3-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 82053664 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 2-methoxy-1-(4-methoxy-2,3-dimethylphenyl)ethanone |
| SMILES | COCC(=O)c1ccc(OC)c(C)c1C |
| InChI | InChI=1S/C12H16O3/c1-8-9(2)12(15-4)6-5-10(8)11(13)7-14-3/h5-6H,7H2,1-4H3 |
| InChIKey | WVZKJJFFKCOGLU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |