About 2-methoxy-1-(4-methoxy-2,3,5-trimethylphenyl)ethanone
2-methoxy-1-(4-methoxy-2,3,5-trimethylphenyl)ethanone (PubChem CID 82053775) has the molecular formula C13H18O3
and a molecular weight of 222.28 g/mol. Its IUPAC name is 2-methoxy-1-(4-methoxy-2,3,5-trimethylphenyl)ethanone.
Analyze 2-methoxy-1-(4-methoxy-2,3,5-trimethylphenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-1-(4-methoxy-2,3,5-trimethylphenyl)ethanone?
The IUPAC name of 2-methoxy-1-(4-methoxy-2,3,5-trimethylphenyl)ethanone (CID 82053775) is 2-methoxy-1-(4-methoxy-2,3,5-trimethylphenyl)ethanone.
What is the SMILES notation for 2-methoxy-1-(4-methoxy-2,3,5-trimethylphenyl)ethanone?
The canonical SMILES for 2-methoxy-1-(4-methoxy-2,3,5-trimethylphenyl)ethanone is COCC(=O)c1cc(C)c(OC)c(C)c1C.
What is the InChIKey of 2-methoxy-1-(4-methoxy-2,3,5-trimethylphenyl)ethanone?
The InChIKey is KOQCASQQMXYTFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3/c1-8-6-11(12(14)7-15-4)9(2)10(3)13(8)16-5/h6H,7H2,1-5H3.
What are the key properties of 2-methoxy-1-(4-methoxy-2,3,5-trimethylphenyl)ethanone?
2-methoxy-1-(4-methoxy-2,3,5-trimethylphenyl)ethanone has a molecular weight of 222.28 g/mol, XLogP of 2.45, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-1-(4-methoxy-2,3,5-trimethylphenyl)ethanone is sourced from PubChem (CID 82053775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).