C12H18N2O2 — CID 116846887
4-methoxy-N',2,3,5-tetramethylbenzohydrazide (PubChem CID 116846887) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 4-methoxy-N',2,3,5-tetramethylbenzohydrazide.
| Compound Name | 4-methoxy-N',2,3,5-tetramethylbenzohydrazide |
|---|---|
| PubChem CID | 116846887 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 4-methoxy-N',2,3,5-tetramethylbenzohydrazide |
| SMILES | CNNC(=O)c1cc(C)c(OC)c(C)c1C |
| InChI | InChI=1S/C12H18N2O2/c1-7-6-10(12(15)14-13-4)8(2)9(3)11(7)16-5/h6,13H,1-5H3,(H,14,15) |
| InChIKey | YTTALJPSIVXMSB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|