C12H14O4 — CID 82286864
2-(4-methoxy-2,3,5-trimethylphenyl)-2-oxoacetic acid (PubChem CID 82286864) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is 2-(4-methoxy-2,3,5-trimethylphenyl)-2-oxoacetic acid.
| Compound Name | 2-(4-methoxy-2,3,5-trimethylphenyl)-2-oxoacetic acid |
|---|---|
| PubChem CID | 82286864 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 2-(4-methoxy-2,3,5-trimethylphenyl)-2-oxoacetic acid |
| SMILES | COc1c(C)cc(C(=O)C(=O)O)c(C)c1C |
| InChI | InChI=1S/C12H14O4/c1-6-5-9(10(13)12(14)15)7(2)8(3)11(6)16-4/h5H,1-4H3,(H,14,15) |
| InChIKey | JTJAEUCGYSQNHS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|