C17H19N3O2 — CID 82056333
[8-[2-(3-methylphenoxy)ethoxy]imidazo[1,2-a]pyridin-3-yl]methanamine (PubChem CID 82056333) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is [8-[2-(3-methylphenoxy)ethoxy]imidazo[1,2-a]pyridin-3-yl]methanamine.
| Compound Name | [8-[2-(3-methylphenoxy)ethoxy]imidazo[1,2-a]pyridin-3-yl]methanamine |
|---|---|
| PubChem CID | 82056333 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | [8-[2-(3-methylphenoxy)ethoxy]imidazo[1,2-a]pyridin-3-yl]methanamine |
| SMILES | Cc1cccc(OCCOc2cccn3c(CN)cnc23)c1 |
| InChI | InChI=1S/C17H19N3O2/c1-13-4-2-5-15(10-13)21-8-9-22-16-6-3-7-20-14(11-18)12-19-17(16)20/h2-7,10,12H,8-9,11,18H2,1H3 |
| InChIKey | KCBBMUSIKHZPGT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|