C15H17NO3S — CID 82058263
3-(6-ethyl-3-oxo-5-phenyl-1,4-thiazin-4-yl)propanoic acid (PubChem CID 82058263) has the molecular formula C15H17NO3S and a molecular weight of 291.37 g/mol. Its IUPAC name is 3-(6-ethyl-3-oxo-5-phenyl-1,4-thiazin-4-yl)propanoic acid.
| Compound Name | 3-(6-ethyl-3-oxo-5-phenyl-1,4-thiazin-4-yl)propanoic acid |
|---|---|
| PubChem CID | 82058263 |
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 3-(6-ethyl-3-oxo-5-phenyl-1,4-thiazin-4-yl)propanoic acid |
| SMILES | CCC1=C(c2ccccc2)N(CCC(=O)O)C(=O)CS1 |
| InChI | InChI=1S/C15H17NO3S/c1-2-12-15(11-6-4-3-5-7-11)16(9-8-14(18)19)13(17)10-20-12/h3-7H,2,8-10H2,1H3,(H,18,19) |
| InChIKey | ZUQZITRTJOXVBM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |