3-(5-methyl-3-oxo-1,4-thiazin-4-yl)propanoic acid

C8H11NO3S — CID 82058290

IUPAC3-(5-methyl-3-oxo-1,4-thiazin-4-yl)propanoic acid
SMILESCC1=CSCC(=O)N1CCC(=O)O
InChIInChI=1S/C8H11NO3S/c1-6-4-13-5-7(10)9(6)3-2-8(11)12/h4H,2-3,5H2,1H3,(H,11,12)
InChIKeyMMXXAFJHHHJDDO-UHFFFAOYSA-N
MW201.25 g/mol
LogP0.90
Rot. Bonds3

About 3-(5-methyl-3-oxo-1,4-thiazin-4-yl)propanoic acid

3-(5-methyl-3-oxo-1,4-thiazin-4-yl)propanoic acid (PubChem CID 82058290) has the molecular formula C8H11NO3S and a molecular weight of 201.25 g/mol. Its IUPAC name is 3-(5-methyl-3-oxo-1,4-thiazin-4-yl)propanoic acid.

Molecular Properties

Compound Name3-(5-methyl-3-oxo-1,4-thiazin-4-yl)propanoic acid
PubChem CID82058290
Molecular FormulaC8H11NO3S
Molecular Weight201.25 g/mol
Exact Mass201.05
IUPAC Name3-(5-methyl-3-oxo-1,4-thiazin-4-yl)propanoic acid
SMILESCC1=CSCC(=O)N1CCC(=O)O
InChIInChI=1S/C8H11NO3S/c1-6-4-13-5-7(10)9(6)3-2-8(11)12/h4H,2-3,5H2,1H3,(H,11,12)
InChIKeyMMXXAFJHHHJDDO-UHFFFAOYSA-N
XLogP0.90
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.25
LogP ≤ 50.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(5-methyl-3-oxo-1,4-thiazin-4-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(5-methyl-3-oxo-1,4-thiazin-4-yl)propanoic acid?
The IUPAC name of 3-(5-methyl-3-oxo-1,4-thiazin-4-yl)propanoic acid (CID 82058290) is 3-(5-methyl-3-oxo-1,4-thiazin-4-yl)propanoic acid.
What is the SMILES notation for 3-(5-methyl-3-oxo-1,4-thiazin-4-yl)propanoic acid?
The canonical SMILES for 3-(5-methyl-3-oxo-1,4-thiazin-4-yl)propanoic acid is CC1=CSCC(=O)N1CCC(=O)O.
What is the InChIKey of 3-(5-methyl-3-oxo-1,4-thiazin-4-yl)propanoic acid?
The InChIKey is MMXXAFJHHHJDDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3S/c1-6-4-13-5-7(10)9(6)3-2-8(11)12/h4H,2-3,5H2,1H3,(H,11,12).
What are the key properties of 3-(5-methyl-3-oxo-1,4-thiazin-4-yl)propanoic acid?
3-(5-methyl-3-oxo-1,4-thiazin-4-yl)propanoic acid has a molecular weight of 201.25 g/mol, XLogP of 0.90, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-methyl-3-oxo-1,4-thiazin-4-yl)propanoic acid is sourced from PubChem (CID 82058290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).