C8H11NO3S — CID 82058290
3-(5-methyl-3-oxo-1,4-thiazin-4-yl)propanoic acid (PubChem CID 82058290) has the molecular formula C8H11NO3S and a molecular weight of 201.25 g/mol. Its IUPAC name is 3-(5-methyl-3-oxo-1,4-thiazin-4-yl)propanoic acid.
| Compound Name | 3-(5-methyl-3-oxo-1,4-thiazin-4-yl)propanoic acid |
|---|---|
| PubChem CID | 82058290 |
| Molecular Formula | C8H11NO3S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 3-(5-methyl-3-oxo-1,4-thiazin-4-yl)propanoic acid |
| SMILES | CC1=CSCC(=O)N1CCC(=O)O |
| InChI | InChI=1S/C8H11NO3S/c1-6-4-13-5-7(10)9(6)3-2-8(11)12/h4H,2-3,5H2,1H3,(H,11,12) |
| InChIKey | MMXXAFJHHHJDDO-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |