C15H17NO3S — CID 82058283
3-[5-(2,4-dimethylphenyl)-3-oxo-1,4-thiazin-4-yl]propanoic acid (PubChem CID 82058283) has the molecular formula C15H17NO3S and a molecular weight of 291.37 g/mol. Its IUPAC name is 3-[5-(2,4-dimethylphenyl)-3-oxo-1,4-thiazin-4-yl]propanoic acid.
| Compound Name | 3-[5-(2,4-dimethylphenyl)-3-oxo-1,4-thiazin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 82058283 |
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 3-[5-(2,4-dimethylphenyl)-3-oxo-1,4-thiazin-4-yl]propanoic acid |
| SMILES | Cc1ccc(C2=CSCC(=O)N2CCC(=O)O)c(C)c1 |
| InChI | InChI=1S/C15H17NO3S/c1-10-3-4-12(11(2)7-10)13-8-20-9-14(17)16(13)6-5-15(18)19/h3-4,7-8H,5-6,9H2,1-2H3,(H,18,19) |
| InChIKey | RPJGDVVYFLAHCF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |