3-[5-(2,4-dimethylphenyl)-3-oxo-1,4-thiazin-4-yl]propanoic acid

C15H17NO3S — CID 82058283

IUPAC3-[5-(2,4-dimethylphenyl)-3-oxo-1,4-thiazin-4-yl]propanoic acid
SMILESCc1ccc(C2=CSCC(=O)N2CCC(=O)O)c(C)c1
InChIInChI=1S/C15H17NO3S/c1-10-3-4-12(11(2)7-10)13-8-20-9-14(17)16(13)6-5-15(18)19/h3-4,7-8H,5-6,9H2,1-2H3,(H,18,19)
InChIKeyRPJGDVVYFLAHCF-UHFFFAOYSA-N
MW291.37 g/mol
LogP2.65
Rot. Bonds4

About 3-[5-(2,4-dimethylphenyl)-3-oxo-1,4-thiazin-4-yl]propanoic acid

3-[5-(2,4-dimethylphenyl)-3-oxo-1,4-thiazin-4-yl]propanoic acid (PubChem CID 82058283) has the molecular formula C15H17NO3S and a molecular weight of 291.37 g/mol. Its IUPAC name is 3-[5-(2,4-dimethylphenyl)-3-oxo-1,4-thiazin-4-yl]propanoic acid.

Molecular Properties

Compound Name3-[5-(2,4-dimethylphenyl)-3-oxo-1,4-thiazin-4-yl]propanoic acid
PubChem CID82058283
Molecular FormulaC15H17NO3S
Molecular Weight291.37 g/mol
Exact Mass291.09
IUPAC Name3-[5-(2,4-dimethylphenyl)-3-oxo-1,4-thiazin-4-yl]propanoic acid
SMILESCc1ccc(C2=CSCC(=O)N2CCC(=O)O)c(C)c1
InChIInChI=1S/C15H17NO3S/c1-10-3-4-12(11(2)7-10)13-8-20-9-14(17)16(13)6-5-15(18)19/h3-4,7-8H,5-6,9H2,1-2H3,(H,18,19)
InChIKeyRPJGDVVYFLAHCF-UHFFFAOYSA-N
XLogP2.65
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.37
LogP ≤ 52.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-[5-(2,4-dimethylphenyl)-3-oxo-1,4-thiazin-4-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[5-(2,4-dimethylphenyl)-3-oxo-1,4-thiazin-4-yl]propanoic acid?
The IUPAC name of 3-[5-(2,4-dimethylphenyl)-3-oxo-1,4-thiazin-4-yl]propanoic acid (CID 82058283) is 3-[5-(2,4-dimethylphenyl)-3-oxo-1,4-thiazin-4-yl]propanoic acid.
What is the SMILES notation for 3-[5-(2,4-dimethylphenyl)-3-oxo-1,4-thiazin-4-yl]propanoic acid?
The canonical SMILES for 3-[5-(2,4-dimethylphenyl)-3-oxo-1,4-thiazin-4-yl]propanoic acid is Cc1ccc(C2=CSCC(=O)N2CCC(=O)O)c(C)c1.
What is the InChIKey of 3-[5-(2,4-dimethylphenyl)-3-oxo-1,4-thiazin-4-yl]propanoic acid?
The InChIKey is RPJGDVVYFLAHCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO3S/c1-10-3-4-12(11(2)7-10)13-8-20-9-14(17)16(13)6-5-15(18)19/h3-4,7-8H,5-6,9H2,1-2H3,(H,18,19).
What are the key properties of 3-[5-(2,4-dimethylphenyl)-3-oxo-1,4-thiazin-4-yl]propanoic acid?
3-[5-(2,4-dimethylphenyl)-3-oxo-1,4-thiazin-4-yl]propanoic acid has a molecular weight of 291.37 g/mol, XLogP of 2.65, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(2,4-dimethylphenyl)-3-oxo-1,4-thiazin-4-yl]propanoic acid is sourced from PubChem (CID 82058283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).