3-[4-(2,4-dimethylphenyl)-2-methylimidazol-1-yl]propanoic acid

C15H18N2O2 — CID 82300508

IUPAC3-[4-(2,4-dimethylphenyl)-2-methylimidazol-1-yl]propanoic acid
SMILESCc1ccc(-c2cn(CCC(=O)O)c(C)n2)c(C)c1
InChIInChI=1S/C15H18N2O2/c1-10-4-5-13(11(2)8-10)14-9-17(12(3)16-14)7-6-15(18)19/h4-5,8-9H,6-7H2,1-3H3,(H,18,19)
InChIKeyWROGMHHNVIXJNO-UHFFFAOYSA-N
MW258.32 g/mol
LogP2.95
Rot. Bonds4

About 3-[4-(2,4-dimethylphenyl)-2-methylimidazol-1-yl]propanoic acid

3-[4-(2,4-dimethylphenyl)-2-methylimidazol-1-yl]propanoic acid (PubChem CID 82300508) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 3-[4-(2,4-dimethylphenyl)-2-methylimidazol-1-yl]propanoic acid.

Molecular Properties

Compound Name3-[4-(2,4-dimethylphenyl)-2-methylimidazol-1-yl]propanoic acid
PubChem CID82300508
Molecular FormulaC15H18N2O2
Molecular Weight258.32 g/mol
Exact Mass258.14
IUPAC Name3-[4-(2,4-dimethylphenyl)-2-methylimidazol-1-yl]propanoic acid
SMILESCc1ccc(-c2cn(CCC(=O)O)c(C)n2)c(C)c1
InChIInChI=1S/C15H18N2O2/c1-10-4-5-13(11(2)8-10)14-9-17(12(3)16-14)7-6-15(18)19/h4-5,8-9H,6-7H2,1-3H3,(H,18,19)
InChIKeyWROGMHHNVIXJNO-UHFFFAOYSA-N
XLogP2.95
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.32
LogP ≤ 52.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-[4-(2,4-dimethylphenyl)-2-methylimidazol-1-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[4-(2,4-dimethylphenyl)-2-methylimidazol-1-yl]propanoic acid?
The IUPAC name of 3-[4-(2,4-dimethylphenyl)-2-methylimidazol-1-yl]propanoic acid (CID 82300508) is 3-[4-(2,4-dimethylphenyl)-2-methylimidazol-1-yl]propanoic acid.
What is the SMILES notation for 3-[4-(2,4-dimethylphenyl)-2-methylimidazol-1-yl]propanoic acid?
The canonical SMILES for 3-[4-(2,4-dimethylphenyl)-2-methylimidazol-1-yl]propanoic acid is Cc1ccc(-c2cn(CCC(=O)O)c(C)n2)c(C)c1.
What is the InChIKey of 3-[4-(2,4-dimethylphenyl)-2-methylimidazol-1-yl]propanoic acid?
The InChIKey is WROGMHHNVIXJNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O2/c1-10-4-5-13(11(2)8-10)14-9-17(12(3)16-14)7-6-15(18)19/h4-5,8-9H,6-7H2,1-3H3,(H,18,19).
What are the key properties of 3-[4-(2,4-dimethylphenyl)-2-methylimidazol-1-yl]propanoic acid?
3-[4-(2,4-dimethylphenyl)-2-methylimidazol-1-yl]propanoic acid has a molecular weight of 258.32 g/mol, XLogP of 2.95, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2,4-dimethylphenyl)-2-methylimidazol-1-yl]propanoic acid is sourced from PubChem (CID 82300508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).