C9H12N2O5S — CID 147847037
3-[3-(2-hydroxyethyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]propanoic acid (PubChem CID 147847037) has the molecular formula C9H12N2O5S and a molecular weight of 260.27 g/mol. Its IUPAC name is 3-[3-(2-hydroxyethyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]propanoic acid.
| Compound Name | 3-[3-(2-hydroxyethyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]propanoic acid |
|---|---|
| PubChem CID | 147847037 |
| Molecular Formula | C9H12N2O5S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 3-[3-(2-hydroxyethyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)CC(=O)N(CCO)C1=S |
| InChI | InChI=1S/C9H12N2O5S/c12-4-3-11-7(14)5-6(13)10(9(11)17)2-1-8(15)16/h12H,1-5H2,(H,15,16) |
| InChIKey | HUCBUSUXDDSZFM-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|