C16H16N2O6S — CID 147758270
3-[3-(2-carboxyethyl)-4,6-dioxo-5-phenyl-2-sulfanylidene-1,3-diazinan-1-yl]propanoic acid (PubChem CID 147758270) has the molecular formula C16H16N2O6S and a molecular weight of 364.38 g/mol. Its IUPAC name is 3-[3-(2-carboxyethyl)-4,6-dioxo-5-phenyl-2-sulfanylidene-1,3-diazinan-1-yl]propanoic acid.
| Compound Name | 3-[3-(2-carboxyethyl)-4,6-dioxo-5-phenyl-2-sulfanylidene-1,3-diazinan-1-yl]propanoic acid |
|---|---|
| PubChem CID | 147758270 |
| Molecular Formula | C16H16N2O6S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 3-[3-(2-carboxyethyl)-4,6-dioxo-5-phenyl-2-sulfanylidene-1,3-diazinan-1-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)C(c2ccccc2)C(=O)N(CCC(=O)O)C1=S |
| InChI | InChI=1S/C16H16N2O6S/c19-11(20)6-8-17-14(23)13(10-4-2-1-3-5-10)15(24)18(16(17)25)9-7-12(21)22/h1-5,13H,6-9H2,(H,19,20)(H,21,22) |
| InChIKey | HDNWGYOXFJEFCO-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|