About 2-tert-butyl-3-(1,4-diazepan-1-ylmethyl)-5-methylimidazo[1,2-a]pyridine
2-tert-butyl-3-(1,4-diazepan-1-ylmethyl)-5-methylimidazo[1,2-a]pyridine (PubChem CID 82058372) has the molecular formula C18H28N4
and a molecular weight of 300.45 g/mol. Its IUPAC name is 2-tert-butyl-3-(1,4-diazepan-1-ylmethyl)-5-methylimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 2-tert-butyl-3-(1,4-diazepan-1-ylmethyl)-5-methylimidazo[1,2-a]pyridine |
| PubChem CID | 82058372 |
| Molecular Formula | C18H28N4 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | 2-tert-butyl-3-(1,4-diazepan-1-ylmethyl)-5-methylimidazo[1,2-a]pyridine |
| SMILES | Cc1cccc2nc(C(C)(C)C)c(CN3CCCNCC3)n12 |
| InChI | InChI=1S/C18H28N4/c1-14-7-5-8-16-20-17(18(2,3)4)15(22(14)16)13-21-11-6-9-19-10-12-21/h5,7-8,19H,6,9-13H2,1-4H3 |
| InChIKey | KPEVZPZPSMSEDG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-tert-butyl-3-(1,4-diazepan-1-ylmethyl)-5-methylimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-3-(1,4-diazepan-1-ylmethyl)-5-methylimidazo[1,2-a]pyridine?
The IUPAC name of 2-tert-butyl-3-(1,4-diazepan-1-ylmethyl)-5-methylimidazo[1,2-a]pyridine (CID 82058372) is 2-tert-butyl-3-(1,4-diazepan-1-ylmethyl)-5-methylimidazo[1,2-a]pyridine.
What is the SMILES notation for 2-tert-butyl-3-(1,4-diazepan-1-ylmethyl)-5-methylimidazo[1,2-a]pyridine?
The canonical SMILES for 2-tert-butyl-3-(1,4-diazepan-1-ylmethyl)-5-methylimidazo[1,2-a]pyridine is Cc1cccc2nc(C(C)(C)C)c(CN3CCCNCC3)n12.
What is the InChIKey of 2-tert-butyl-3-(1,4-diazepan-1-ylmethyl)-5-methylimidazo[1,2-a]pyridine?
The InChIKey is KPEVZPZPSMSEDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N4/c1-14-7-5-8-16-20-17(18(2,3)4)15(22(14)16)13-21-11-6-9-19-10-12-21/h5,7-8,19H,6,9-13H2,1-4H3.
What are the key properties of 2-tert-butyl-3-(1,4-diazepan-1-ylmethyl)-5-methylimidazo[1,2-a]pyridine?
2-tert-butyl-3-(1,4-diazepan-1-ylmethyl)-5-methylimidazo[1,2-a]pyridine has a molecular weight of 300.45 g/mol, XLogP of 2.74, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-3-(1,4-diazepan-1-ylmethyl)-5-methylimidazo[1,2-a]pyridine is sourced from PubChem (CID 82058372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).