About 6-methyl-[1,2,4]triazolo[4,3-a]pyridin-8-amine
6-methyl-[1,2,4]triazolo[4,3-a]pyridin-8-amine (PubChem CID 82059481) has the molecular formula C7H8N4
and a molecular weight of 148.17 g/mol. Its IUPAC name is 6-methyl-[1,2,4]triazolo[4,3-a]pyridin-8-amine.
Analyze 6-methyl-[1,2,4]triazolo[4,3-a]pyridin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-[1,2,4]triazolo[4,3-a]pyridin-8-amine?
The IUPAC name of 6-methyl-[1,2,4]triazolo[4,3-a]pyridin-8-amine (CID 82059481) is 6-methyl-[1,2,4]triazolo[4,3-a]pyridin-8-amine.
What is the SMILES notation for 6-methyl-[1,2,4]triazolo[4,3-a]pyridin-8-amine?
The canonical SMILES for 6-methyl-[1,2,4]triazolo[4,3-a]pyridin-8-amine is Cc1cc(N)c2nncn2c1.
What is the InChIKey of 6-methyl-[1,2,4]triazolo[4,3-a]pyridin-8-amine?
The InChIKey is WNOWNKSDMGXZQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4/c1-5-2-6(8)7-10-9-4-11(7)3-5/h2-4H,8H2,1H3.
What are the key properties of 6-methyl-[1,2,4]triazolo[4,3-a]pyridin-8-amine?
6-methyl-[1,2,4]triazolo[4,3-a]pyridin-8-amine has a molecular weight of 148.17 g/mol, XLogP of 0.62, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-[1,2,4]triazolo[4,3-a]pyridin-8-amine is sourced from PubChem (CID 82059481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).