About 2-(4-ethoxyphenyl)-3,7-dimethylimidazo[1,2-a]pyridin-8-amine
2-(4-ethoxyphenyl)-3,7-dimethylimidazo[1,2-a]pyridin-8-amine (PubChem CID 82059990) has the molecular formula C17H19N3O
and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-3,7-dimethylimidazo[1,2-a]pyridin-8-amine.
Molecular Properties
| Compound Name | 2-(4-ethoxyphenyl)-3,7-dimethylimidazo[1,2-a]pyridin-8-amine |
| PubChem CID | 82059990 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 2-(4-ethoxyphenyl)-3,7-dimethylimidazo[1,2-a]pyridin-8-amine |
| SMILES | CCOc1ccc(-c2nc3c(N)c(C)ccn3c2C)cc1 |
| InChI | InChI=1S/C17H19N3O/c1-4-21-14-7-5-13(6-8-14)16-12(3)20-10-9-11(2)15(18)17(20)19-16/h5-10H,4,18H2,1-3H3 |
| InChIKey | URASROVHTRWIGF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-ethoxyphenyl)-3,7-dimethylimidazo[1,2-a]pyridin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethoxyphenyl)-3,7-dimethylimidazo[1,2-a]pyridin-8-amine?
The IUPAC name of 2-(4-ethoxyphenyl)-3,7-dimethylimidazo[1,2-a]pyridin-8-amine (CID 82059990) is 2-(4-ethoxyphenyl)-3,7-dimethylimidazo[1,2-a]pyridin-8-amine.
What is the SMILES notation for 2-(4-ethoxyphenyl)-3,7-dimethylimidazo[1,2-a]pyridin-8-amine?
The canonical SMILES for 2-(4-ethoxyphenyl)-3,7-dimethylimidazo[1,2-a]pyridin-8-amine is CCOc1ccc(-c2nc3c(N)c(C)ccn3c2C)cc1.
What is the InChIKey of 2-(4-ethoxyphenyl)-3,7-dimethylimidazo[1,2-a]pyridin-8-amine?
The InChIKey is URASROVHTRWIGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O/c1-4-21-14-7-5-13(6-8-14)16-12(3)20-10-9-11(2)15(18)17(20)19-16/h5-10H,4,18H2,1-3H3.
What are the key properties of 2-(4-ethoxyphenyl)-3,7-dimethylimidazo[1,2-a]pyridin-8-amine?
2-(4-ethoxyphenyl)-3,7-dimethylimidazo[1,2-a]pyridin-8-amine has a molecular weight of 281.36 g/mol, XLogP of 3.60, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethoxyphenyl)-3,7-dimethylimidazo[1,2-a]pyridin-8-amine is sourced from PubChem (CID 82059990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).