C19H21N3O — CID 94823737
3,8-dimethyl-2-[4-(2-methylprop-2-enoxy)phenyl]imidazo[1,2-a]pyridin-6-amine (PubChem CID 94823737) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is 3,8-dimethyl-2-[4-(2-methylprop-2-enoxy)phenyl]imidazo[1,2-a]pyridin-6-amine.
| Compound Name | 3,8-dimethyl-2-[4-(2-methylprop-2-enoxy)phenyl]imidazo[1,2-a]pyridin-6-amine |
|---|---|
| PubChem CID | 94823737 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 3,8-dimethyl-2-[4-(2-methylprop-2-enoxy)phenyl]imidazo[1,2-a]pyridin-6-amine |
| SMILES | C=C(C)COc1ccc(-c2nc3c(C)cc(N)cn3c2C)cc1 |
| InChI | InChI=1S/C19H21N3O/c1-12(2)11-23-17-7-5-15(6-8-17)18-14(4)22-10-16(20)9-13(3)19(22)21-18/h5-10H,1,11,20H2,2-4H3 |
| InChIKey | NAXGRWLWZBLWHV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|