C10H13N3 — CID 82059110
2,3,8-trimethylimidazo[1,2-a]pyridin-6-amine (PubChem CID 82059110) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is 2,3,8-trimethylimidazo[1,2-a]pyridin-6-amine.
| Compound Name | 2,3,8-trimethylimidazo[1,2-a]pyridin-6-amine |
|---|---|
| PubChem CID | 82059110 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 2,3,8-trimethylimidazo[1,2-a]pyridin-6-amine |
| SMILES | Cc1nc2c(C)cc(N)cn2c1C |
| InChI | InChI=1S/C10H13N3/c1-6-4-9(11)5-13-8(3)7(2)12-10(6)13/h4-5H,11H2,1-3H3 |
| InChIKey | BGAUXPSUYLBCCS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |