C8H7Br2N3 — CID 170993894
6,8-dibromo-2,3-dimethylimidazo[1,2-a]pyrazine (PubChem CID 170993894) has the molecular formula C8H7Br2N3 and a molecular weight of 304.97 g/mol. Its IUPAC name is 6,8-dibromo-2,3-dimethylimidazo[1,2-a]pyrazine.
| Compound Name | 6,8-dibromo-2,3-dimethylimidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 170993894 |
| Molecular Formula | C8H7Br2N3 |
| Molecular Weight | 304.97 g/mol |
| Exact Mass | 302.90 |
| IUPAC Name | 6,8-dibromo-2,3-dimethylimidazo[1,2-a]pyrazine |
| SMILES | Cc1nc2c(Br)nc(Br)cn2c1C |
| InChI | InChI=1S/C8H7Br2N3/c1-4-5(2)13-3-6(9)12-7(10)8(13)11-4/h3H,1-2H3 |
| InChIKey | YOOFLPRZESFDEW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.97 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |