C16H13N3O2 — CID 82060349
2-(2,5-dimethoxyphenyl)imidazo[1,2-a]pyridine-6-carbonitrile (PubChem CID 82060349) has the molecular formula C16H13N3O2 and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)imidazo[1,2-a]pyridine-6-carbonitrile.
| Compound Name | 2-(2,5-dimethoxyphenyl)imidazo[1,2-a]pyridine-6-carbonitrile |
|---|---|
| PubChem CID | 82060349 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)imidazo[1,2-a]pyridine-6-carbonitrile |
| SMILES | COc1ccc(OC)c(-c2cn3cc(C#N)ccc3n2)c1 |
| InChI | InChI=1S/C16H13N3O2/c1-20-12-4-5-15(21-2)13(7-12)14-10-19-9-11(8-17)3-6-16(19)18-14/h3-7,9-10H,1-2H3 |
| InChIKey | UFKQFWKPTKHWFK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 59.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |