C14H13ClN2S — CID 82061936
6-(chloromethyl)-3-(2,4-dimethylphenyl)imidazo[2,1-b][1,3]thiazole (PubChem CID 82061936) has the molecular formula C14H13ClN2S and a molecular weight of 276.79 g/mol. Its IUPAC name is 6-(chloromethyl)-3-(2,4-dimethylphenyl)imidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-(chloromethyl)-3-(2,4-dimethylphenyl)imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 82061936 |
| Molecular Formula | C14H13ClN2S |
| Molecular Weight | 276.79 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 6-(chloromethyl)-3-(2,4-dimethylphenyl)imidazo[2,1-b][1,3]thiazole |
| SMILES | Cc1ccc(-c2csc3nc(CCl)cn23)c(C)c1 |
| InChI | InChI=1S/C14H13ClN2S/c1-9-3-4-12(10(2)5-9)13-8-18-14-16-11(6-15)7-17(13)14/h3-5,7-8H,6H2,1-2H3 |
| InChIKey | VWOOGUCZEFDLCI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.79 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|