C17H21N5OS — CID 108728180
3-[6-(2,4-dimethylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-1,1-diethylurea (PubChem CID 108728180) has the molecular formula C17H21N5OS and a molecular weight of 343.46 g/mol. Its IUPAC name is 3-[6-(2,4-dimethylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-1,1-diethylurea.
| Compound Name | 3-[6-(2,4-dimethylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-1,1-diethylurea |
|---|---|
| PubChem CID | 108728180 |
| Molecular Formula | C17H21N5OS |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 3-[6-(2,4-dimethylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nc1nc2scc(-c3ccc(C)cc3C)n2n1 |
| InChI | InChI=1S/C17H21N5OS/c1-5-21(6-2)16(23)18-15-19-17-22(20-15)14(10-24-17)13-8-7-11(3)9-12(13)4/h7-10H,5-6H2,1-4H3,(H,18,20,23) |
| InChIKey | ICOIZMIBEUADMO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |