C22H20N4O2S — CID 108752111
(E)-N-[6-(2,4-dimethylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 108752111) has the molecular formula C22H20N4O2S and a molecular weight of 404.50 g/mol. Its IUPAC name is (E)-N-[6-(2,4-dimethylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[6-(2,4-dimethylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108752111 |
| Molecular Formula | C22H20N4O2S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | (E)-N-[6-(2,4-dimethylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2nc3scc(-c4ccc(C)cc4C)n3n2)cc1 |
| InChI | InChI=1S/C22H20N4O2S/c1-14-4-10-18(15(2)12-14)19-13-29-22-24-21(25-26(19)22)23-20(27)11-7-16-5-8-17(28-3)9-6-16/h4-13H,1-3H3,(H,23,25,27)/b11-7+ |
| InChIKey | LOWNNXUKZOXHRL-YRNVUSSQSA-N |
| XLogP | 4.74 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|