C21H22N4O3S2 — CID 108780619
N-[6-(2,4-dimethylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-2-methoxy-4,5-dimethylbenzenesulfonamide (PubChem CID 108780619) has the molecular formula C21H22N4O3S2 and a molecular weight of 442.57 g/mol. Its IUPAC name is N-[6-(2,4-dimethylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-2-methoxy-4,5-dimethylbenzenesulfonamide.
| Compound Name | N-[6-(2,4-dimethylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-2-methoxy-4,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 108780619 |
| Molecular Formula | C21H22N4O3S2 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | N-[6-(2,4-dimethylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-2-methoxy-4,5-dimethylbenzenesulfonamide |
| SMILES | COc1cc(C)c(C)cc1S(=O)(=O)Nc1nc2scc(-c3ccc(C)cc3C)n2n1 |
| InChI | InChI=1S/C21H22N4O3S2/c1-12-6-7-16(15(4)8-12)17-11-29-21-22-20(23-25(17)21)24-30(26,27)19-10-14(3)13(2)9-18(19)28-5/h6-11H,1-5H3,(H,23,24) |
| InChIKey | GQFHBRIPIKBTAB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |