C15H16N2O — CID 82063293
1-(2-aminoethyl)-4-[(E)-2-phenylethenyl]pyridin-2-one (PubChem CID 82063293) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is 1-(2-aminoethyl)-4-[(E)-2-phenylethenyl]pyridin-2-one.
| Compound Name | 1-(2-aminoethyl)-4-[(E)-2-phenylethenyl]pyridin-2-one |
|---|---|
| PubChem CID | 82063293 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 1-(2-aminoethyl)-4-[(E)-2-phenylethenyl]pyridin-2-one |
| SMILES | NCCn1ccc(/C=C/c2ccccc2)cc1=O |
| InChI | InChI=1S/C15H16N2O/c16-9-11-17-10-8-14(12-15(17)18)7-6-13-4-2-1-3-5-13/h1-8,10,12H,9,11,16H2/b7-6+ |
| InChIKey | AXUUGDCFIJERAB-VOTSOKGWSA-N |
| XLogP | 1.98 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |