C17H19NO2 — CID 82150999
1-(3-hydroxypropyl)-4-[(E)-2-(3-methylphenyl)ethenyl]pyridin-2-one (PubChem CID 82150999) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-4-[(E)-2-(3-methylphenyl)ethenyl]pyridin-2-one.
| Compound Name | 1-(3-hydroxypropyl)-4-[(E)-2-(3-methylphenyl)ethenyl]pyridin-2-one |
|---|---|
| PubChem CID | 82150999 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 1-(3-hydroxypropyl)-4-[(E)-2-(3-methylphenyl)ethenyl]pyridin-2-one |
| SMILES | Cc1cccc(/C=C/c2ccn(CCCO)c(=O)c2)c1 |
| InChI | InChI=1S/C17H19NO2/c1-14-4-2-5-15(12-14)6-7-16-8-10-18(9-3-11-19)17(20)13-16/h2,4-8,10,12-13,19H,3,9,11H2,1H3/b7-6+ |
| InChIKey | CMNMNZGTBMOSOR-VOTSOKGWSA-N |
| XLogP | 2.71 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |