C14H19NO4 — CID 82064554
3-[2-(azepan-1-yl)-2-oxoethoxy]-2-methylpyran-4-one (PubChem CID 82064554) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 3-[2-(azepan-1-yl)-2-oxoethoxy]-2-methylpyran-4-one.
| Compound Name | 3-[2-(azepan-1-yl)-2-oxoethoxy]-2-methylpyran-4-one |
|---|---|
| PubChem CID | 82064554 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 3-[2-(azepan-1-yl)-2-oxoethoxy]-2-methylpyran-4-one |
| SMILES | Cc1occc(=O)c1OCC(=O)N1CCCCCC1 |
| InChI | InChI=1S/C14H19NO4/c1-11-14(12(16)6-9-18-11)19-10-13(17)15-7-4-2-3-5-8-15/h6,9H,2-5,7-8,10H2,1H3 |
| InChIKey | UFISZZFVXMTEIP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |