C17H18ClN3S — CID 82066650
2-chloro-N-(3-methylbutyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 82066650) has the molecular formula C17H18ClN3S and a molecular weight of 331.87 g/mol. Its IUPAC name is 2-chloro-N-(3-methylbutyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-N-(3-methylbutyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 82066650 |
| Molecular Formula | C17H18ClN3S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 2-chloro-N-(3-methylbutyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CC(C)CCNc1nc(Cl)nc2scc(-c3ccccc3)c12 |
| InChI | InChI=1S/C17H18ClN3S/c1-11(2)8-9-19-15-14-13(12-6-4-3-5-7-12)10-22-16(14)21-17(18)20-15/h3-7,10-11H,8-9H2,1-2H3,(H,19,20,21) |
| InChIKey | BKMDIMGKVLVRLL-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |