C13H19N5O — CID 82067484
2-(4-amino-2-tert-butylbenzimidazol-1-yl)acetohydrazide (PubChem CID 82067484) has the molecular formula C13H19N5O and a molecular weight of 261.33 g/mol. Its IUPAC name is 2-(4-amino-2-tert-butylbenzimidazol-1-yl)acetohydrazide.
| Compound Name | 2-(4-amino-2-tert-butylbenzimidazol-1-yl)acetohydrazide |
|---|---|
| PubChem CID | 82067484 |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 2-(4-amino-2-tert-butylbenzimidazol-1-yl)acetohydrazide |
| SMILES | CC(C)(C)c1nc2c(N)cccc2n1CC(=O)NN |
| InChI | InChI=1S/C13H19N5O/c1-13(2,3)12-16-11-8(14)5-4-6-9(11)18(12)7-10(19)17-15/h4-6H,7,14-15H2,1-3H3,(H,17,19) |
| InChIKey | IETMWQLWIYEZIC-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|