C12H15N5O — CID 82067577
2-(4-amino-2-cyclopropylbenzimidazol-1-yl)acetohydrazide (PubChem CID 82067577) has the molecular formula C12H15N5O and a molecular weight of 245.29 g/mol. Its IUPAC name is 2-(4-amino-2-cyclopropylbenzimidazol-1-yl)acetohydrazide.
| Compound Name | 2-(4-amino-2-cyclopropylbenzimidazol-1-yl)acetohydrazide |
|---|---|
| PubChem CID | 82067577 |
| Molecular Formula | C12H15N5O |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 2-(4-amino-2-cyclopropylbenzimidazol-1-yl)acetohydrazide |
| SMILES | NNC(=O)Cn1c(C2CC2)nc2c(N)cccc21 |
| InChI | InChI=1S/C12H15N5O/c13-8-2-1-3-9-11(8)15-12(7-4-5-7)17(9)6-10(18)16-14/h1-3,7H,4-6,13-14H2,(H,16,18) |
| InChIKey | XFSFALXXZZECAU-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|