C13H15ClN2S — CID 82069519
2-[4-(4-chlorophenyl)-2-ethyl-1,3-thiazol-5-yl]ethanamine (PubChem CID 82069519) has the molecular formula C13H15ClN2S and a molecular weight of 266.80 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-2-ethyl-1,3-thiazol-5-yl]ethanamine.
| Compound Name | 2-[4-(4-chlorophenyl)-2-ethyl-1,3-thiazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 82069519 |
| Molecular Formula | C13H15ClN2S |
| Molecular Weight | 266.80 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-2-ethyl-1,3-thiazol-5-yl]ethanamine |
| SMILES | CCc1nc(-c2ccc(Cl)cc2)c(CCN)s1 |
| InChI | InChI=1S/C13H15ClN2S/c1-2-12-16-13(11(17-12)7-8-15)9-3-5-10(14)6-4-9/h3-6H,2,7-8,15H2,1H3 |
| InChIKey | KKHSSIKFAIWSRU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.80 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |