C7H11BrN2S — CID 83824283
2-(4-bromo-2-ethyl-1,3-thiazol-5-yl)ethanamine (PubChem CID 83824283) has the molecular formula C7H11BrN2S and a molecular weight of 235.15 g/mol. Its IUPAC name is 2-(4-bromo-2-ethyl-1,3-thiazol-5-yl)ethanamine.
| Compound Name | 2-(4-bromo-2-ethyl-1,3-thiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 83824283 |
| Molecular Formula | C7H11BrN2S |
| Molecular Weight | 235.15 g/mol |
| Exact Mass | 233.98 |
| IUPAC Name | 2-(4-bromo-2-ethyl-1,3-thiazol-5-yl)ethanamine |
| SMILES | CCc1nc(Br)c(CCN)s1 |
| InChI | InChI=1S/C7H11BrN2S/c1-2-6-10-7(8)5(11-6)3-4-9/h2-4,9H2,1H3 |
| InChIKey | PSGSPHPZLLMKRA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.15 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |