C15H26N2O3 — CID 82071614
1-(3-amino-4-methylphenyl)-2-[bis(2-methoxyethyl)amino]ethanol (PubChem CID 82071614) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is 1-(3-amino-4-methylphenyl)-2-[bis(2-methoxyethyl)amino]ethanol.
| Compound Name | 1-(3-amino-4-methylphenyl)-2-[bis(2-methoxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 82071614 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 1-(3-amino-4-methylphenyl)-2-[bis(2-methoxyethyl)amino]ethanol |
| SMILES | COCCN(CCOC)CC(O)c1ccc(C)c(N)c1 |
| InChI | InChI=1S/C15H26N2O3/c1-12-4-5-13(10-14(12)16)15(18)11-17(6-8-19-2)7-9-20-3/h4-5,10,15,18H,6-9,11,16H2,1-3H3 |
| InChIKey | OQXPANJQEABDJO-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|