About (5-pyridin-3-yl-4,5-dihydro-1H-pyrazol-3-yl)methanamine
(5-pyridin-3-yl-4,5-dihydro-1H-pyrazol-3-yl)methanamine (PubChem CID 82072815) has the molecular formula C9H12N4
and a molecular weight of 176.22 g/mol. Its IUPAC name is (5-pyridin-3-yl-4,5-dihydro-1H-pyrazol-3-yl)methanamine.
Molecular Properties
| Compound Name | (5-pyridin-3-yl-4,5-dihydro-1H-pyrazol-3-yl)methanamine |
| PubChem CID | 82072815 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | (5-pyridin-3-yl-4,5-dihydro-1H-pyrazol-3-yl)methanamine |
| SMILES | NCC1=NNC(c2cccnc2)C1 |
| InChI | InChI=1S/C9H12N4/c10-5-8-4-9(13-12-8)7-2-1-3-11-6-7/h1-3,6,9,13H,4-5,10H2 |
| InChIKey | QQVXTWNASUOUKW-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-pyridin-3-yl-4,5-dihydro-1H-pyrazol-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-pyridin-3-yl-4,5-dihydro-1H-pyrazol-3-yl)methanamine?
The IUPAC name of (5-pyridin-3-yl-4,5-dihydro-1H-pyrazol-3-yl)methanamine (CID 82072815) is (5-pyridin-3-yl-4,5-dihydro-1H-pyrazol-3-yl)methanamine.
What is the SMILES notation for (5-pyridin-3-yl-4,5-dihydro-1H-pyrazol-3-yl)methanamine?
The canonical SMILES for (5-pyridin-3-yl-4,5-dihydro-1H-pyrazol-3-yl)methanamine is NCC1=NNC(c2cccnc2)C1.
What is the InChIKey of (5-pyridin-3-yl-4,5-dihydro-1H-pyrazol-3-yl)methanamine?
The InChIKey is QQVXTWNASUOUKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4/c10-5-8-4-9(13-12-8)7-2-1-3-11-6-7/h1-3,6,9,13H,4-5,10H2.
What are the key properties of (5-pyridin-3-yl-4,5-dihydro-1H-pyrazol-3-yl)methanamine?
(5-pyridin-3-yl-4,5-dihydro-1H-pyrazol-3-yl)methanamine has a molecular weight of 176.22 g/mol, XLogP of 0.43, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-pyridin-3-yl-4,5-dihydro-1H-pyrazol-3-yl)methanamine is sourced from PubChem (CID 82072815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).