C15H27NOS2 — CID 82074553
3-[tert-butyl(ethyl)amino]-1-(5-ethylsulfanylthiophen-2-yl)propan-1-ol (PubChem CID 82074553) has the molecular formula C15H27NOS2 and a molecular weight of 301.52 g/mol. Its IUPAC name is 3-[tert-butyl(ethyl)amino]-1-(5-ethylsulfanylthiophen-2-yl)propan-1-ol.
| Compound Name | 3-[tert-butyl(ethyl)amino]-1-(5-ethylsulfanylthiophen-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 82074553 |
| Molecular Formula | C15H27NOS2 |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 3-[tert-butyl(ethyl)amino]-1-(5-ethylsulfanylthiophen-2-yl)propan-1-ol |
| SMILES | CCSc1ccc(C(O)CCN(CC)C(C)(C)C)s1 |
| InChI | InChI=1S/C15H27NOS2/c1-6-16(15(3,4)5)11-10-12(17)13-8-9-14(19-13)18-7-2/h8-9,12,17H,6-7,10-11H2,1-5H3 |
| InChIKey | XXDWEXOMEGCLEV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |