C16H27NOS2 — CID 82074571
3-(2-methylpiperidin-1-yl)-1-(5-propylsulfanylthiophen-2-yl)propan-1-ol (PubChem CID 82074571) has the molecular formula C16H27NOS2 and a molecular weight of 313.53 g/mol. Its IUPAC name is 3-(2-methylpiperidin-1-yl)-1-(5-propylsulfanylthiophen-2-yl)propan-1-ol.
| Compound Name | 3-(2-methylpiperidin-1-yl)-1-(5-propylsulfanylthiophen-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 82074571 |
| Molecular Formula | C16H27NOS2 |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 3-(2-methylpiperidin-1-yl)-1-(5-propylsulfanylthiophen-2-yl)propan-1-ol |
| SMILES | CCCSc1ccc(C(O)CCN2CCCCC2C)s1 |
| InChI | InChI=1S/C16H27NOS2/c1-3-12-19-16-8-7-15(20-16)14(18)9-11-17-10-5-4-6-13(17)2/h7-8,13-14,18H,3-6,9-12H2,1-2H3 |
| InChIKey | RQVKVFSVVYUYJX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |