C13H23N — CID 82075897
1-(2-methylpropyl)-1,2,3,4,5,6,7,8-octahydroisoquinoline (PubChem CID 82075897) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 1-(2-methylpropyl)-1,2,3,4,5,6,7,8-octahydroisoquinoline.
| Compound Name | 1-(2-methylpropyl)-1,2,3,4,5,6,7,8-octahydroisoquinoline |
|---|---|
| PubChem CID | 82075897 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 1-(2-methylpropyl)-1,2,3,4,5,6,7,8-octahydroisoquinoline |
| SMILES | CC(C)CC1NCCC2=C1CCCC2 |
| InChI | InChI=1S/C13H23N/c1-10(2)9-13-12-6-4-3-5-11(12)7-8-14-13/h10,13-14H,3-9H2,1-2H3 |
| InChIKey | IPPQHSAYKBYJOH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|