C18H32N2S — CID 11381294
4-(2-methylpropyl)-3,4,5,6,7,8,9,10,11,12,13,14-dodecahydro-1H-cyclododeca[d]pyrimidine-2-thione (PubChem CID 11381294) has the molecular formula C18H32N2S and a molecular weight of 308.54 g/mol. Its IUPAC name is 4-(2-methylpropyl)-3,4,5,6,7,8,9,10,11,12,13,14-dodecahydro-1H-cyclododeca[d]pyrimidine-2-thione.
| Compound Name | 4-(2-methylpropyl)-3,4,5,6,7,8,9,10,11,12,13,14-dodecahydro-1H-cyclododeca[d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 11381294 |
| Molecular Formula | C18H32N2S |
| Molecular Weight | 308.54 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 4-(2-methylpropyl)-3,4,5,6,7,8,9,10,11,12,13,14-dodecahydro-1H-cyclododeca[d]pyrimidine-2-thione |
| SMILES | CC(C)CC1NC(=S)NC2=C1CCCCCCCCCC2 |
| InChI | InChI=1S/C18H32N2S/c1-14(2)13-17-15-11-9-7-5-3-4-6-8-10-12-16(15)19-18(21)20-17/h14,17H,3-13H2,1-2H3,(H2,19,20,21) |
| InChIKey | QPPHDAQGLUKKFZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.54 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|