C20H34O — CID 142031692
7,7-dimethyl-9-(2-methylpropyl)-2,3,4,4b,5,6,8,8a,9,10-decahydro-1H-phenanthren-1-ol (PubChem CID 142031692) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is 7,7-dimethyl-9-(2-methylpropyl)-2,3,4,4b,5,6,8,8a,9,10-decahydro-1H-phenanthren-1-ol.
| Compound Name | 7,7-dimethyl-9-(2-methylpropyl)-2,3,4,4b,5,6,8,8a,9,10-decahydro-1H-phenanthren-1-ol |
|---|---|
| PubChem CID | 142031692 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | 7,7-dimethyl-9-(2-methylpropyl)-2,3,4,4b,5,6,8,8a,9,10-decahydro-1H-phenanthren-1-ol |
| SMILES | CC(C)CC1CC2=C(CCCC2O)C2CCC(C)(C)CC12 |
| InChI | InChI=1S/C20H34O/c1-13(2)10-14-11-17-15(6-5-7-19(17)21)16-8-9-20(3,4)12-18(14)16/h13-14,16,18-19,21H,5-12H2,1-4H3 |
| InChIKey | LZQDZZKNVDUBBH-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|