C14H17N — CID 82076345
2-(2,3-dihydro-1H-inden-5-yl)pentanenitrile (PubChem CID 82076345) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-yl)pentanenitrile.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-yl)pentanenitrile |
|---|---|
| PubChem CID | 82076345 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-yl)pentanenitrile |
| SMILES | CCCC(C#N)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C14H17N/c1-2-4-14(10-15)13-8-7-11-5-3-6-12(11)9-13/h7-9,14H,2-6H2,1H3 |
| InChIKey | RXPGQMYNRQCTQQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |