C14H16N2O — CID 82081347
[2-(3,5-dimethylanilino)-3-pyridinyl]methanol (PubChem CID 82081347) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is [2-(3,5-dimethylanilino)-3-pyridinyl]methanol.
| Compound Name | [2-(3,5-dimethylanilino)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 82081347 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | [2-(3,5-dimethylanilino)-3-pyridinyl]methanol |
| SMILES | Cc1cc(C)cc(Nc2ncccc2CO)c1 |
| InChI | InChI=1S/C14H16N2O/c1-10-6-11(2)8-13(7-10)16-14-12(9-17)4-3-5-15-14/h3-8,17H,9H2,1-2H3,(H,15,16) |
| InChIKey | HZSWRXDNSLUMBM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |