C14H17N3O2S — CID 53151398
2-(3,5-dimethylanilino)-N-methylpyridine-3-sulfonamide (PubChem CID 53151398) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 2-(3,5-dimethylanilino)-N-methylpyridine-3-sulfonamide.
| Compound Name | 2-(3,5-dimethylanilino)-N-methylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 53151398 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 2-(3,5-dimethylanilino)-N-methylpyridine-3-sulfonamide |
| SMILES | CNS(=O)(=O)c1cccnc1Nc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C14H17N3O2S/c1-10-7-11(2)9-12(8-10)17-14-13(5-4-6-16-14)20(18,19)15-3/h4-9,15H,1-3H3,(H,16,17) |
| InChIKey | CVHONLOKSRTHOD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |