C12H12N2O3 — CID 82082347
5-amino-4-(2,4-dimethylphenyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 82082347) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is 5-amino-4-(2,4-dimethylphenyl)-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-amino-4-(2,4-dimethylphenyl)-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 82082347 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 5-amino-4-(2,4-dimethylphenyl)-1,2-oxazole-3-carboxylic acid |
| SMILES | Cc1ccc(-c2c(C(=O)O)noc2N)c(C)c1 |
| InChI | InChI=1S/C12H12N2O3/c1-6-3-4-8(7(2)5-6)9-10(12(15)16)14-17-11(9)13/h3-5H,13H2,1-2H3,(H,15,16) |
| InChIKey | KQUQRYVSZMJOBZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |